About ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene
ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene (PubChem CID 134185786) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene.
Molecular Properties
| Compound Name | ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene |
| PubChem CID | 134185786 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene |
| SMILES | C=C/N=N/C(C)=C(\C=C)C(C)C |
| InChI | InChI=1S/C10H16N2/c1-6-10(8(3)4)9(5)12-11-7-2/h6-8H,1-2H2,3-5H3/b10-9+,12-11+ |
| InChIKey | GVTJLOONUJDVKV-HULFFUFUSA-N |
| XLogP | 3.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene?
The IUPAC name of ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene (CID 134185786) is ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene.
What is the SMILES notation for ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene?
The canonical SMILES for ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene is C=C/N=N/C(C)=C(\C=C)C(C)C.
What is the InChIKey of ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene?
The InChIKey is GVTJLOONUJDVKV-HULFFUFUSA-N. The full InChI is InChI=1S/C10H16N2/c1-6-10(8(3)4)9(5)12-11-7-2/h6-8H,1-2H2,3-5H3/b10-9+,12-11+.
What are the key properties of ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene?
ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene has a molecular weight of 164.25 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]diazene is sourced from PubChem (CID 134185786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).