About 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane
2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane (PubChem CID 134185934) has the molecular formula C15H22S3
and a molecular weight of 298.54 g/mol. Its IUPAC name is 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane.
Analyze 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane?
The IUPAC name of 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane (CID 134185934) is 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane.
What is the SMILES notation for 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane?
The canonical SMILES for 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane is C1CC2SCC34CC(SC3C3CCCC3S4)C2C1.
What is the InChIKey of 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane?
The InChIKey is SQWBYFUDBAINHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22S3/c1-3-9-11(5-1)16-8-15-7-13(9)17-14(15)10-4-2-6-12(10)18-15/h9-14H,1-8H2.
What are the key properties of 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane?
2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane has a molecular weight of 298.54 g/mol, XLogP of 4.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9,16-trithiapentacyclo[8.7.1.01,8.03,7.011,15]octadecane is sourced from PubChem (CID 134185934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).