C26H29NO4 — CID 134186040
[(8E)-4-methoxy-11,13-dimethyl-6-oxa-13-azatetracyclo[10.5.1.05,17.07,16]octadeca-1(17),2,4,8-tetraen-8-yl] benzoate (PubChem CID 134186040) has the molecular formula C26H29NO4 and a molecular weight of 419.52 g/mol. Its IUPAC name is [(8E)-4-methoxy-11,13-dimethyl-6-oxa-13-azatetracyclo[10.5.1.05,17.07,16]octadeca-1(17),2,4,8-tetraen-8-yl] benzoate.
| Compound Name | [(8E)-4-methoxy-11,13-dimethyl-6-oxa-13-azatetracyclo[10.5.1.05,17.07,16]octadeca-1(17),2,4,8-tetraen-8-yl] benzoate |
|---|---|
| PubChem CID | 134186040 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | [(8E)-4-methoxy-11,13-dimethyl-6-oxa-13-azatetracyclo[10.5.1.05,17.07,16]octadeca-1(17),2,4,8-tetraen-8-yl] benzoate |
| SMILES | COc1ccc2c3c1OC1/C(OC(=O)c4ccccc4)=C\CC(C)C(C2)N(C)CCC31 |
| InChI | InChI=1S/C26H29NO4/c1-16-9-11-22(30-26(28)17-7-5-4-6-8-17)24-19-13-14-27(2)20(16)15-18-10-12-21(29-3)25(31-24)23(18)19/h4-8,10-12,16,19-20,24H,9,13-15H2,1-3H3/b22-11+ |
| InChIKey | CARZCPDQSXGPOW-SSDVNMTOSA-N |
| XLogP | 4.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |