C14H23F2N3 — CID 134186168
(4S,5R)-1-tert-butyl-6,6-difluoro-N,N,4,5-tetramethyl-4,5-dihydrocyclopenta[d]pyrazol-3-amine (PubChem CID 134186168) has the molecular formula C14H23F2N3 and a molecular weight of 271.35 g/mol. Its IUPAC name is (4S,5R)-1-tert-butyl-6,6-difluoro-N,N,4,5-tetramethyl-4,5-dihydrocyclopenta[d]pyrazol-3-amine.
| Compound Name | (4S,5R)-1-tert-butyl-6,6-difluoro-N,N,4,5-tetramethyl-4,5-dihydrocyclopenta[d]pyrazol-3-amine |
|---|---|
| PubChem CID | 134186168 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (4S,5R)-1-tert-butyl-6,6-difluoro-N,N,4,5-tetramethyl-4,5-dihydrocyclopenta[d]pyrazol-3-amine |
| SMILES | C[C@@H]1c2c(N(C)C)nn(C(C)(C)C)c2C(F)(F)[C@@H]1C |
| InChI | InChI=1S/C14H23F2N3/c1-8-9(2)14(15,16)11-10(8)12(18(6)7)17-19(11)13(3,4)5/h8-9H,1-7H3/t8-,9+/m0/s1 |
| InChIKey | LOPYCHALFIBMEM-DTWKUNHWSA-N |
| XLogP | 3.55 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |