C11H13F2IN2 — CID 134186169
(2S)-7-tert-butyl-5,5-difluoro-9-iodo-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene (PubChem CID 134186169) has the molecular formula C11H13F2IN2 and a molecular weight of 338.14 g/mol. Its IUPAC name is (2S)-7-tert-butyl-5,5-difluoro-9-iodo-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene.
| Compound Name | (2S)-7-tert-butyl-5,5-difluoro-9-iodo-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene |
|---|---|
| PubChem CID | 134186169 |
| Molecular Formula | C11H13F2IN2 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | (2S)-7-tert-butyl-5,5-difluoro-9-iodo-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-diene |
| SMILES | CC(C)(C)n1nc(I)c2c1C(F)(F)C1C[C@H]21 |
| InChI | InChI=1S/C11H13F2IN2/c1-10(2,3)16-8-7(9(14)15-16)5-4-6(5)11(8,12)13/h5-6H,4H2,1-3H3/t5-,6?/m0/s1 |
| InChIKey | YYDYMMOCHQUOQF-ZBHICJROSA-N |
| XLogP | 3.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|