About 1-methoxy-3,5-dimethylcyclohexa-1,3-diene
1-methoxy-3,5-dimethylcyclohexa-1,3-diene (PubChem CID 13418692) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-methoxy-3,5-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-methoxy-3,5-dimethylcyclohexa-1,3-diene |
| PubChem CID | 13418692 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 1-methoxy-3,5-dimethylcyclohexa-1,3-diene |
| SMILES | COC1=CC(C)=CC(C)C1 |
| InChI | InChI=1S/C9H14O/c1-7-4-8(2)6-9(5-7)10-3/h4-5,8H,6H2,1-3H3 |
| InChIKey | OUBDELPREQSIQY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-3,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of 1-methoxy-3,5-dimethylcyclohexa-1,3-diene (CID 13418692) is 1-methoxy-3,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 1-methoxy-3,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 1-methoxy-3,5-dimethylcyclohexa-1,3-diene is COC1=CC(C)=CC(C)C1.
What is the InChIKey of 1-methoxy-3,5-dimethylcyclohexa-1,3-diene?
The InChIKey is OUBDELPREQSIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-7-4-8(2)6-9(5-7)10-3/h4-5,8H,6H2,1-3H3.
What are the key properties of 1-methoxy-3,5-dimethylcyclohexa-1,3-diene?
1-methoxy-3,5-dimethylcyclohexa-1,3-diene has a molecular weight of 138.21 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 13418692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).