C26H27F3N2O3 — CID 134186953
3-[[4-[(E)-C-methyl-N-[[4-[4-(trifluoromethyl)phenyl]cyclohexa-1,3-dien-1-yl]methoxy]carbonimidoyl]phenyl]methylamino]propanoic acid (PubChem CID 134186953) has the molecular formula C26H27F3N2O3 and a molecular weight of 472.51 g/mol. Its IUPAC name is 3-[[4-[(E)-C-methyl-N-[[4-[4-(trifluoromethyl)phenyl]cyclohexa-1,3-dien-1-yl]methoxy]carbonimidoyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[(E)-C-methyl-N-[[4-[4-(trifluoromethyl)phenyl]cyclohexa-1,3-dien-1-yl]methoxy]carbonimidoyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 134186953 |
| Molecular Formula | C26H27F3N2O3 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 3-[[4-[(E)-C-methyl-N-[[4-[4-(trifluoromethyl)phenyl]cyclohexa-1,3-dien-1-yl]methoxy]carbonimidoyl]phenyl]methylamino]propanoic acid |
| SMILES | C/C(=N\OCC1=CC=C(c2ccc(C(F)(F)F)cc2)CC1)c1ccc(CNCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H27F3N2O3/c1-18(21-6-2-19(3-7-21)16-30-15-14-25(32)33)31-34-17-20-4-8-22(9-5-20)23-10-12-24(13-11-23)26(27,28)29/h2-4,6-8,10-13,30H,5,9,14-17H2,1H3,(H,32,33)/b31-18+ |
| InChIKey | VUPOOMHDKWLTKY-FDAWAROLSA-N |
| XLogP | 5.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|