C22H28FNO2S — CID 134186958
3-[(3S,5R)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline (PubChem CID 134186958) has the molecular formula C22H28FNO2S and a molecular weight of 389.54 g/mol. Its IUPAC name is 3-[(3S,5R)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline.
| Compound Name | 3-[(3S,5R)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline |
|---|---|
| PubChem CID | 134186958 |
| Molecular Formula | C22H28FNO2S |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-[(3S,5R)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline |
| SMILES | CCCC[C@@]1(CC)C[C@H](c2cccc(N)c2)c2cc(F)ccc2S(=O)(=O)C1 |
| InChI | InChI=1S/C22H28FNO2S/c1-3-5-11-22(4-2)14-20(16-7-6-8-18(24)12-16)19-13-17(23)9-10-21(19)27(25,26)15-22/h6-10,12-13,20H,3-5,11,14-15,24H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | NHMNQURHVXFAJH-IRLDBZIGSA-N |
| XLogP | 5.30 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|