C20H24FNOS — CID 134186961
3-[(5R)-3-butyl-7-fluoro-1-oxo-2,3,4,5-tetrahydro-1λ4-benzothiepin-5-yl]aniline (PubChem CID 134186961) has the molecular formula C20H24FNOS and a molecular weight of 345.48 g/mol. Its IUPAC name is 3-[(5R)-3-butyl-7-fluoro-1-oxo-2,3,4,5-tetrahydro-1λ4-benzothiepin-5-yl]aniline.
| Compound Name | 3-[(5R)-3-butyl-7-fluoro-1-oxo-2,3,4,5-tetrahydro-1λ4-benzothiepin-5-yl]aniline |
|---|---|
| PubChem CID | 134186961 |
| Molecular Formula | C20H24FNOS |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[(5R)-3-butyl-7-fluoro-1-oxo-2,3,4,5-tetrahydro-1λ4-benzothiepin-5-yl]aniline |
| SMILES | CCCCC1C[C@H](c2cccc(N)c2)c2cc(F)ccc2S(=O)C1 |
| InChI | InChI=1S/C20H24FNOS/c1-2-3-5-14-10-18(15-6-4-7-17(22)11-15)19-12-16(21)8-9-20(19)24(23)13-14/h4,6-9,11-12,14,18H,2-3,5,10,13,22H2,1H3/t14?,18-,24?/m1/s1 |
| InChIKey | DGYPCPLBUVCWFO-VDXQWWEDSA-N |
| XLogP | 4.86 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|