C19H22FNO2S — CID 134186978
3-[(3S,5R)-3-ethyl-7-fluoro-3-methyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline (PubChem CID 134186978) has the molecular formula C19H22FNO2S and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[(3S,5R)-3-ethyl-7-fluoro-3-methyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline.
| Compound Name | 3-[(3S,5R)-3-ethyl-7-fluoro-3-methyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline |
|---|---|
| PubChem CID | 134186978 |
| Molecular Formula | C19H22FNO2S |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[(3S,5R)-3-ethyl-7-fluoro-3-methyl-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-5-yl]aniline |
| SMILES | CC[C@@]1(C)C[C@H](c2cccc(N)c2)c2cc(F)ccc2S(=O)(=O)C1 |
| InChI | InChI=1S/C19H22FNO2S/c1-3-19(2)11-17(13-5-4-6-15(21)9-13)16-10-14(20)7-8-18(16)24(22,23)12-19/h4-10,17H,3,11-12,21H2,1-2H3/t17-,19+/m1/s1 |
| InChIKey | LNKJIJVQLMUQES-MJGOQNOKSA-N |
| XLogP | 4.13 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|