C30H40FN5O3 — CID 134187195
(1Z)-1-[[2-fluoro-4-(1,4-oxazocan-4-yl)cyclohepta-1,3,6-trien-1-yl]-methylhydrazinylidene]-3-methoxy-1-[2-[(3E,5Z)-octa-3,5-dien-4-yl]pyrazol-3-yl]but-3-en-2-one (PubChem CID 134187195) has the molecular formula C30H40FN5O3 and a molecular weight of 537.68 g/mol. Its IUPAC name is (1Z)-1-[[2-fluoro-4-(1,4-oxazocan-4-yl)cyclohepta-1,3,6-trien-1-yl]-methylhydrazinylidene]-3-methoxy-1-[2-[(3E,5Z)-octa-3,5-dien-4-yl]pyrazol-3-yl]but-3-en-2-one.
| Compound Name | (1Z)-1-[[2-fluoro-4-(1,4-oxazocan-4-yl)cyclohepta-1,3,6-trien-1-yl]-methylhydrazinylidene]-3-methoxy-1-[2-[(3E,5Z)-octa-3,5-dien-4-yl]pyrazol-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 134187195 |
| Molecular Formula | C30H40FN5O3 |
| Molecular Weight | 537.68 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | (1Z)-1-[[2-fluoro-4-(1,4-oxazocan-4-yl)cyclohepta-1,3,6-trien-1-yl]-methylhydrazinylidene]-3-methoxy-1-[2-[(3E,5Z)-octa-3,5-dien-4-yl]pyrazol-3-yl]but-3-en-2-one |
| SMILES | C=C(OC)C(=O)/C(=N\N(C)C1=C(F)C=C(N2CCCCOCC2)CC=C1)c1ccnn1C(/C=C\CC)=C/CC |
| InChI | InChI=1S/C30H40FN5O3/c1-6-8-13-24(12-7-2)36-28(16-17-32-36)29(30(37)23(3)38-5)33-34(4)27-15-11-14-25(22-26(27)31)35-18-9-10-20-39-21-19-35/h8,11-13,15-17,22H,3,6-7,9-10,14,18-21H2,1-2,4-5H3/b13-8-,24-12+,33-29- |
| InChIKey | NHACIUCFGMVAJK-MZGCATHMSA-N |
| XLogP | 5.60 |
| TPSA | 72.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|