C16H20FN3 — CID 134187538
N'-[(2E,4E)-5-cyano-3-fluoropenta-2,4-dien-2-yl]-N-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]ethanimidamide (PubChem CID 134187538) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is N'-[(2E,4E)-5-cyano-3-fluoropenta-2,4-dien-2-yl]-N-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]ethanimidamide.
| Compound Name | N'-[(2E,4E)-5-cyano-3-fluoropenta-2,4-dien-2-yl]-N-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 134187538 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N'-[(2E,4E)-5-cyano-3-fluoropenta-2,4-dien-2-yl]-N-[(3Z,5Z)-4-methylhepta-1,3,5-trien-2-yl]ethanimidamide |
| SMILES | C=C(/C=C(C)\C=C/C)N/C(C)=N/C(C)=C(F)\C=C\C#N |
| InChI | InChI=1S/C16H20FN3/c1-6-8-12(2)11-13(3)19-15(5)20-14(4)16(17)9-7-10-18/h6-9,11H,3H2,1-2,4-5H3,(H,19,20)/b8-6-,9-7+,12-11-,16-14+ |
| InChIKey | KQROTHFMGXZOET-ISNVGMDKSA-N |
| XLogP | 4.31 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|