C24H33FN2 — CID 134187539
(4E,6E)-N-[(2E,3E)-2-ethylidene-4-[(2-methylprop-2-enylideneamino)methyl]hexa-3,5-dienyl]-7-fluoro-3,6-dimethylnona-1,4,6,8-tetraen-4-amine (PubChem CID 134187539) has the molecular formula C24H33FN2 and a molecular weight of 368.54 g/mol. Its IUPAC name is (4E,6E)-N-[(2E,3E)-2-ethylidene-4-[(2-methylprop-2-enylideneamino)methyl]hexa-3,5-dienyl]-7-fluoro-3,6-dimethylnona-1,4,6,8-tetraen-4-amine.
| Compound Name | (4E,6E)-N-[(2E,3E)-2-ethylidene-4-[(2-methylprop-2-enylideneamino)methyl]hexa-3,5-dienyl]-7-fluoro-3,6-dimethylnona-1,4,6,8-tetraen-4-amine |
|---|---|
| PubChem CID | 134187539 |
| Molecular Formula | C24H33FN2 |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | (4E,6E)-N-[(2E,3E)-2-ethylidene-4-[(2-methylprop-2-enylideneamino)methyl]hexa-3,5-dienyl]-7-fluoro-3,6-dimethylnona-1,4,6,8-tetraen-4-amine |
| SMILES | C=C/C(=C\C(=C/C)CN/C(=C/C(C)=C(/F)C=C)C(C)C=C)C/N=C/C(=C)C |
| InChI | InChI=1S/C24H33FN2/c1-9-19(7)24(13-20(8)23(25)12-4)27-17-22(11-3)14-21(10-2)16-26-15-18(5)6/h9-15,19,27H,1-2,4-5,16-17H2,3,6-8H3/b21-14+,22-11+,23-20+,24-13+,26-15+ |
| InChIKey | JZAGSOUUNUCKPZ-KCZDFFPISA-N |
| XLogP | 6.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|