C30H47N3 — CID 134187705
(3Z,5E)-2-N-[(3Z)-3-butan-2-ylidene-4-methyliminocyclohexa-1,5-dien-1-yl]-6-N-(2,5-dimethylheptan-3-yl)-3-ethenyl-5-methylhepta-1,3,5-triene-2,6-diamine (PubChem CID 134187705) has the molecular formula C30H47N3 and a molecular weight of 449.73 g/mol. Its IUPAC name is (3Z,5E)-2-N-[(3Z)-3-butan-2-ylidene-4-methyliminocyclohexa-1,5-dien-1-yl]-6-N-(2,5-dimethylheptan-3-yl)-3-ethenyl-5-methylhepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3Z,5E)-2-N-[(3Z)-3-butan-2-ylidene-4-methyliminocyclohexa-1,5-dien-1-yl]-6-N-(2,5-dimethylheptan-3-yl)-3-ethenyl-5-methylhepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187705 |
| Molecular Formula | C30H47N3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.38 |
| IUPAC Name | (3Z,5E)-2-N-[(3Z)-3-butan-2-ylidene-4-methyliminocyclohexa-1,5-dien-1-yl]-6-N-(2,5-dimethylheptan-3-yl)-3-ethenyl-5-methylhepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C/C(=C/C(C)=C(\C)NC(CC(C)CC)C(C)C)C(=C)NC1=CC(=C(\C)CC)/C(=N/C)C=C1 |
| InChI | InChI=1S/C30H47N3/c1-12-21(6)17-30(20(4)5)33-24(9)23(8)18-26(14-3)25(10)32-27-15-16-29(31-11)28(19-27)22(7)13-2/h14-16,18-21,30,32-33H,3,10,12-13,17H2,1-2,4-9,11H3/b24-23+,26-18-,28-22-,31-29+ |
| InChIKey | CSYWERLBLKKZOY-PDMLIVANSA-N |
| XLogP | 7.80 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|