C22H38FN3 — CID 134187710
(3E,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)pentan-2-yl]-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine (PubChem CID 134187710) has the molecular formula C22H38FN3 and a molecular weight of 363.57 g/mol. Its IUPAC name is (3E,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)pentan-2-yl]-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3E,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)pentan-2-yl]-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187710 |
| Molecular Formula | C22H38FN3 |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | (3E,5Z)-6-N-[(3S)-3-(4,4-dimethylpent-1-en-2-ylamino)pentan-2-yl]-5-fluoro-3-prop-1-en-2-ylhepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C(CC(C)(C)C)N[C@@H](CC)C(C)N/C(C)=C(F)/C=C(\C(=C)C)C(=C)N |
| InChI | InChI=1S/C22H38FN3/c1-11-21(25-15(4)13-22(8,9)10)18(7)26-17(6)20(23)12-19(14(2)3)16(5)24/h12,18,21,25-26H,2,4-5,11,13,24H2,1,3,6-10H3/b19-12+,20-17-/t18?,21-/m0/s1 |
| InChIKey | CTMUNKPMFHINKQ-OZLXXRSOSA-N |
| XLogP | 5.46 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|