C37H61FN2 — CID 134187748
3-N-(4,4-dimethylpent-1-en-2-yl)-2-N-[(2Z,4Z,8Z,9E)-3-fluoro-10-methyl-6-methylidene-5-prop-1-en-2-yl-8-prop-2-enylidenepentadeca-2,4,9-trien-2-yl]-4-methylhexane-2,3-diamine (PubChem CID 134187748) has the molecular formula C37H61FN2 and a molecular weight of 552.91 g/mol. Its IUPAC name is 3-N-(4,4-dimethylpent-1-en-2-yl)-2-N-[(2Z,4Z,8Z,9E)-3-fluoro-10-methyl-6-methylidene-5-prop-1-en-2-yl-8-prop-2-enylidenepentadeca-2,4,9-trien-2-yl]-4-methylhexane-2,3-diamine.
| Compound Name | 3-N-(4,4-dimethylpent-1-en-2-yl)-2-N-[(2Z,4Z,8Z,9E)-3-fluoro-10-methyl-6-methylidene-5-prop-1-en-2-yl-8-prop-2-enylidenepentadeca-2,4,9-trien-2-yl]-4-methylhexane-2,3-diamine |
|---|---|
| PubChem CID | 134187748 |
| Molecular Formula | C37H61FN2 |
| Molecular Weight | 552.91 g/mol |
| Exact Mass | 552.48 |
| IUPAC Name | 3-N-(4,4-dimethylpent-1-en-2-yl)-2-N-[(2Z,4Z,8Z,9E)-3-fluoro-10-methyl-6-methylidene-5-prop-1-en-2-yl-8-prop-2-enylidenepentadeca-2,4,9-trien-2-yl]-4-methylhexane-2,3-diamine |
| SMILES | C=C/C=C(\C=C(/C)CCCCC)CC(=C)/C(=C\C(F)=C(/C)NC(C)C(NC(=C)CC(C)(C)C)C(C)CC)C(=C)C |
| InChI | InChI=1S/C37H61FN2/c1-15-18-19-21-27(6)22-33(20-16-2)23-29(8)34(26(4)5)24-35(38)31(10)40-32(11)36(28(7)17-3)39-30(9)25-37(12,13)14/h16,20,22,24,28,32,36,39-40H,2,4,8-9,15,17-19,21,23,25H2,1,3,5-7,10-14H3/b27-22+,33-20+,34-24-,35-31- |
| InChIKey | OAASEITYNKQEBB-ZSCJJQMWSA-N |
| XLogP | 11.21 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.91 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|