C15H26FN3 — CID 134187793
(3Z,4Z)-3-ethylidene-5-fluoro-2-N,2-N,4-N,7-tetramethyl-4-N-(methylideneamino)octa-4,6-diene-2,4-diamine (PubChem CID 134187793) has the molecular formula C15H26FN3 and a molecular weight of 267.39 g/mol. Its IUPAC name is (3Z,4Z)-3-ethylidene-5-fluoro-2-N,2-N,4-N,7-tetramethyl-4-N-(methylideneamino)octa-4,6-diene-2,4-diamine.
| Compound Name | (3Z,4Z)-3-ethylidene-5-fluoro-2-N,2-N,4-N,7-tetramethyl-4-N-(methylideneamino)octa-4,6-diene-2,4-diamine |
|---|---|
| PubChem CID | 134187793 |
| Molecular Formula | C15H26FN3 |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | (3Z,4Z)-3-ethylidene-5-fluoro-2-N,2-N,4-N,7-tetramethyl-4-N-(methylideneamino)octa-4,6-diene-2,4-diamine |
| SMILES | C=NN(C)C(/C(=C\C)C(C)N(C)C)=C(\F)C=C(C)C |
| InChI | InChI=1S/C15H26FN3/c1-9-13(12(4)18(6)7)15(19(8)17-5)14(16)10-11(2)3/h9-10,12H,5H2,1-4,6-8H3/b13-9-,15-14- |
| InChIKey | WVBJMOUJJAPJJT-UEJBEBQQSA-N |
| XLogP | 3.58 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|