C25H41FN6 — CID 134187856
(3Z,5Z)-5-(1-aminoethenyl)-2-N-[(3S)-3-fluoropentan-2-yl]-3-methyl-6-N-[(E)-1-[1-[methyl-[(Z)-prop-2-enylideneamino]amino]propan-2-ylideneamino]prop-1-en-2-yl]hepta-1,3,5-triene-2,6-diamine (PubChem CID 134187856) has the molecular formula C25H41FN6 and a molecular weight of 444.64 g/mol. Its IUPAC name is (3Z,5Z)-5-(1-aminoethenyl)-2-N-[(3S)-3-fluoropentan-2-yl]-3-methyl-6-N-[(E)-1-[1-[methyl-[(Z)-prop-2-enylideneamino]amino]propan-2-ylideneamino]prop-1-en-2-yl]hepta-1,3,5-triene-2,6-diamine.
| Compound Name | (3Z,5Z)-5-(1-aminoethenyl)-2-N-[(3S)-3-fluoropentan-2-yl]-3-methyl-6-N-[(E)-1-[1-[methyl-[(Z)-prop-2-enylideneamino]amino]propan-2-ylideneamino]prop-1-en-2-yl]hepta-1,3,5-triene-2,6-diamine |
|---|---|
| PubChem CID | 134187856 |
| Molecular Formula | C25H41FN6 |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (3Z,5Z)-5-(1-aminoethenyl)-2-N-[(3S)-3-fluoropentan-2-yl]-3-methyl-6-N-[(E)-1-[1-[methyl-[(Z)-prop-2-enylideneamino]amino]propan-2-ylideneamino]prop-1-en-2-yl]hepta-1,3,5-triene-2,6-diamine |
| SMILES | C=C/C=N\N(C)C/C(C)=N/C=C(\C)N/C(C)=C(/C=C(/C)C(=C)NC(C)[C@@H](F)CC)C(=C)N |
| InChI | InChI=1S/C25H41FN6/c1-11-13-29-32(10)16-19(5)28-15-18(4)30-22(8)24(20(6)27)14-17(3)21(7)31-23(9)25(26)12-2/h11,13-15,23,25,30-31H,1,6-7,12,16,27H2,2-5,8-10H3/b17-14-,18-15+,24-22-,28-19+,29-13-/t23?,25-/m0/s1 |
| InChIKey | NNJCCJQDFZOMBB-UVOAQFGUSA-N |
| XLogP | 4.93 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|