C24H39FN4S — CID 134187860
N-[2-[[(2Z,4Z)-5-(1-aminoethenyl)-3-fluoro-6-[[(2E)-penta-2,4-dien-2-yl]amino]hepta-2,4,6-trien-2-yl]amino]butyl]-3,3-dimethylbutanethioamide (PubChem CID 134187860) has the molecular formula C24H39FN4S and a molecular weight of 434.67 g/mol. Its IUPAC name is N-[2-[[(2Z,4Z)-5-(1-aminoethenyl)-3-fluoro-6-[[(2E)-penta-2,4-dien-2-yl]amino]hepta-2,4,6-trien-2-yl]amino]butyl]-3,3-dimethylbutanethioamide.
| Compound Name | N-[2-[[(2Z,4Z)-5-(1-aminoethenyl)-3-fluoro-6-[[(2E)-penta-2,4-dien-2-yl]amino]hepta-2,4,6-trien-2-yl]amino]butyl]-3,3-dimethylbutanethioamide |
|---|---|
| PubChem CID | 134187860 |
| Molecular Formula | C24H39FN4S |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | N-[2-[[(2Z,4Z)-5-(1-aminoethenyl)-3-fluoro-6-[[(2E)-penta-2,4-dien-2-yl]amino]hepta-2,4,6-trien-2-yl]amino]butyl]-3,3-dimethylbutanethioamide |
| SMILES | C=C/C=C(\C)NC(=C)/C(=C\C(F)=C(/C)NC(CC)CNC(=S)CC(C)(C)C)C(=C)N |
| InChI | InChI=1S/C24H39FN4S/c1-10-12-16(3)28-18(5)21(17(4)26)13-22(25)19(6)29-20(11-2)15-27-23(30)14-24(7,8)9/h10,12-13,20,28-29H,1,4-5,11,14-15,26H2,2-3,6-9H3,(H,27,30)/b16-12+,21-13-,22-19- |
| InChIKey | DLDQLHKHHWXDGH-XUMQZLFUSA-N |
| XLogP | 5.50 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|