C17H19FN6 — CID 134187928
3-(1-aminoethenyl)-5-fluoro-2-N-[3-[methyl-[(Z)-prop-2-enylideneamino]amino]phenyl]pyridine-2,6-diamine (PubChem CID 134187928) has the molecular formula C17H19FN6 and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-(1-aminoethenyl)-5-fluoro-2-N-[3-[methyl-[(Z)-prop-2-enylideneamino]amino]phenyl]pyridine-2,6-diamine.
| Compound Name | 3-(1-aminoethenyl)-5-fluoro-2-N-[3-[methyl-[(Z)-prop-2-enylideneamino]amino]phenyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 134187928 |
| Molecular Formula | C17H19FN6 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-(1-aminoethenyl)-5-fluoro-2-N-[3-[methyl-[(Z)-prop-2-enylideneamino]amino]phenyl]pyridine-2,6-diamine |
| SMILES | C=C/C=N\N(C)c1cccc(Nc2nc(N)c(F)cc2C(=C)N)c1 |
| InChI | InChI=1S/C17H19FN6/c1-4-8-21-24(3)13-7-5-6-12(9-13)22-17-14(11(2)19)10-15(18)16(20)23-17/h4-10H,1-2,19H2,3H3,(H3,20,22,23)/b21-8- |
| InChIKey | AFWXBLIHTXYPOX-WNFQYIGGSA-N |
| XLogP | 3.08 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|