C21H26FN3 — CID 134188061
(3Z)-3-ethenyl-5-fluoro-6-methyl-N-[(2E,4E)-5-(4-methylpyrazol-1-yl)hepta-2,4,6-trien-3-yl]hepta-1,3,5-trien-2-amine (PubChem CID 134188061) has the molecular formula C21H26FN3 and a molecular weight of 339.46 g/mol. Its IUPAC name is (3Z)-3-ethenyl-5-fluoro-6-methyl-N-[(2E,4E)-5-(4-methylpyrazol-1-yl)hepta-2,4,6-trien-3-yl]hepta-1,3,5-trien-2-amine.
| Compound Name | (3Z)-3-ethenyl-5-fluoro-6-methyl-N-[(2E,4E)-5-(4-methylpyrazol-1-yl)hepta-2,4,6-trien-3-yl]hepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134188061 |
| Molecular Formula | C21H26FN3 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (3Z)-3-ethenyl-5-fluoro-6-methyl-N-[(2E,4E)-5-(4-methylpyrazol-1-yl)hepta-2,4,6-trien-3-yl]hepta-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C/C(F)=C(C)C)C(=C)NC(=C/C)/C=C(\C=C)n1cc(C)cn1 |
| InChI | InChI=1S/C21H26FN3/c1-8-18(11-21(22)15(4)5)17(7)24-19(9-2)12-20(10-3)25-14-16(6)13-23-25/h8-14,24H,1,3,7H2,2,4-6H3/b18-11-,19-9+,20-12+ |
| InChIKey | AWFCODJUAKCQNN-WDYZNFGSSA-N |
| XLogP | 5.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|