C27H29NO3 — CID 134188409
3-buta-1,3-dien-2-yl-3-[(2E,4E)-5-(2-methoxyethoxy)hexa-2,4-dien-2-yl]-2-phenylisoindol-1-one (PubChem CID 134188409) has the molecular formula C27H29NO3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-3-[(2E,4E)-5-(2-methoxyethoxy)hexa-2,4-dien-2-yl]-2-phenylisoindol-1-one.
| Compound Name | 3-buta-1,3-dien-2-yl-3-[(2E,4E)-5-(2-methoxyethoxy)hexa-2,4-dien-2-yl]-2-phenylisoindol-1-one |
|---|---|
| PubChem CID | 134188409 |
| Molecular Formula | C27H29NO3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-3-[(2E,4E)-5-(2-methoxyethoxy)hexa-2,4-dien-2-yl]-2-phenylisoindol-1-one |
| SMILES | C=CC(=C)C1(/C(C)=C/C=C(\C)OCCOC)c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H29NO3/c1-6-20(2)27(21(3)16-17-22(4)31-19-18-30-5)25-15-11-10-14-24(25)26(29)28(27)23-12-8-7-9-13-23/h6-17H,1-2,18-19H2,3-5H3/b21-16+,22-17+ |
| InChIKey | DBAFHBJCKWBFFO-LPFJTETCSA-N |
| XLogP | 5.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|