C32H30ClFN4O2 — CID 134188692
N-[(1E,3E)-2-[2-(5-chloro-2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-[4-(2-morpholin-4-ylethoxy)phenyl]penta-1,3-dienyl]methanimine (PubChem CID 134188692) has the molecular formula C32H30ClFN4O2 and a molecular weight of 557.07 g/mol. Its IUPAC name is N-[(1E,3E)-2-[2-(5-chloro-2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-[4-(2-morpholin-4-ylethoxy)phenyl]penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3E)-2-[2-(5-chloro-2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-[4-(2-morpholin-4-ylethoxy)phenyl]penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 134188692 |
| Molecular Formula | C32H30ClFN4O2 |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | N-[(1E,3E)-2-[2-(5-chloro-2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-[4-(2-morpholin-4-ylethoxy)phenyl]penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)c1ccc(OCCN2CCOCC2)cc1)c1cc(-c2cc(Cl)ccc2F)nc2ncccc12 |
| InChI | InChI=1S/C32H30ClFN4O2/c1-22(23-5-8-26(9-6-23)40-17-14-38-12-15-39-16-13-38)18-24(21-35-2)28-20-31(29-19-25(33)7-10-30(29)34)37-32-27(28)4-3-11-36-32/h3-11,18-21H,2,12-17H2,1H3/b22-18+,24-21+ |
| InChIKey | YYVCINZRONSMMC-MWPSNXSNSA-N |
| XLogP | 6.95 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|