C34H43N3O4 — CID 134188703
2-[6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-6-oxo-2-propylhexyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide (PubChem CID 134188703) has the molecular formula C34H43N3O4 and a molecular weight of 557.74 g/mol. Its IUPAC name is 2-[6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-6-oxo-2-propylhexyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide.
| Compound Name | 2-[6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-6-oxo-2-propylhexyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide |
|---|---|
| PubChem CID | 134188703 |
| Molecular Formula | C34H43N3O4 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | 2-[6-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxyphenyl]-6-oxo-2-propylhexyl]-N-(2-methoxyethyl)-4-methylindazole-5-carboxamide |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(C(=O)CCCC(CCC)Cn2cc3c(C)c(C(=O)NCCOC)ccc3n2)cc1 |
| InChI | InChI=1S/C34H43N3O4/c1-6-9-13-28(8-3)41-29-17-15-27(16-18-29)33(38)14-10-12-26(11-7-2)23-37-24-31-25(4)30(19-20-32(31)36-37)34(39)35-21-22-40-5/h6,8-9,13,15-20,24,26H,3,7,10-12,14,21-23H2,1-2,4-5H3,(H,35,39)/b9-6-,28-13+ |
| InChIKey | PQHUTQGZYHSZND-DSEHHBOGSA-N |
| XLogP | 7.22 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|