C17H25F2N3 — CID 134189006
N-(2,2-difluoroethyl)-N'-[4-methyl-3-(3-methyl-2-methylidene-1-pyridinyl)penta-1,3-dien-2-yl]ethane-1,2-diamine (PubChem CID 134189006) has the molecular formula C17H25F2N3 and a molecular weight of 309.40 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N'-[4-methyl-3-(3-methyl-2-methylidene-1-pyridinyl)penta-1,3-dien-2-yl]ethane-1,2-diamine.
| Compound Name | N-(2,2-difluoroethyl)-N'-[4-methyl-3-(3-methyl-2-methylidene-1-pyridinyl)penta-1,3-dien-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 134189006 |
| Molecular Formula | C17H25F2N3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-(2,2-difluoroethyl)-N'-[4-methyl-3-(3-methyl-2-methylidene-1-pyridinyl)penta-1,3-dien-2-yl]ethane-1,2-diamine |
| SMILES | C=C(NCCNCC(F)F)C(=C(C)C)N1C=CC=C(C)C1=C |
| InChI | InChI=1S/C17H25F2N3/c1-12(2)17(22-10-6-7-13(3)15(22)5)14(4)21-9-8-20-11-16(18)19/h6-7,10,16,20-21H,4-5,8-9,11H2,1-3H3 |
| InChIKey | YPJBFYCFGKTMCT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|