C32H46F2N2 — CID 134189180
N,6-diethyl-3-[C-[2-fluoro-4-(6-fluoro-2,3,4-trimethylphenyl)phenyl]-N-methylcarbonimidoyl]-N,2-dimethylnon-1-en-4-amine (PubChem CID 134189180) has the molecular formula C32H46F2N2 and a molecular weight of 496.73 g/mol. Its IUPAC name is N,6-diethyl-3-[C-[2-fluoro-4-(6-fluoro-2,3,4-trimethylphenyl)phenyl]-N-methylcarbonimidoyl]-N,2-dimethylnon-1-en-4-amine.
| Compound Name | N,6-diethyl-3-[C-[2-fluoro-4-(6-fluoro-2,3,4-trimethylphenyl)phenyl]-N-methylcarbonimidoyl]-N,2-dimethylnon-1-en-4-amine |
|---|---|
| PubChem CID | 134189180 |
| Molecular Formula | C32H46F2N2 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | N,6-diethyl-3-[C-[2-fluoro-4-(6-fluoro-2,3,4-trimethylphenyl)phenyl]-N-methylcarbonimidoyl]-N,2-dimethylnon-1-en-4-amine |
| SMILES | C=C(C)C(/C(=N\C)c1ccc(-c2c(F)cc(C)c(C)c2C)cc1F)C(CC(CC)CCC)N(C)CC |
| InChI | InChI=1S/C32H46F2N2/c1-11-14-24(12-2)18-29(36(10)13-3)30(20(4)5)32(35-9)26-16-15-25(19-27(26)33)31-23(8)22(7)21(6)17-28(31)34/h15-17,19,24,29-30H,4,11-14,18H2,1-3,5-10H3/b35-32- |
| InChIKey | CWIXEWPPDBCNGS-JCUPVDEDSA-N |
| XLogP | 8.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|