C5H8FN — CID 134189427
(Z)-3-fluoro-N,2-dimethylprop-2-en-1-imine (PubChem CID 134189427) has the molecular formula C5H8FN and a molecular weight of 101.12 g/mol. Its IUPAC name is (Z)-3-fluoro-N,2-dimethylprop-2-en-1-imine.
| Compound Name | (Z)-3-fluoro-N,2-dimethylprop-2-en-1-imine |
|---|---|
| PubChem CID | 134189427 |
| Molecular Formula | C5H8FN |
| Molecular Weight | 101.12 g/mol |
| Exact Mass | 101.06 |
| IUPAC Name | (Z)-3-fluoro-N,2-dimethylprop-2-en-1-imine |
| SMILES | C/N=C/C(C)=C\F |
| InChI | InChI=1S/C5H8FN/c1-5(3-6)4-7-2/h3-4H,1-2H3/b5-3-,7-4+ |
| InChIKey | LATLNEHAQXEEME-XKSOLRDRSA-N |
| XLogP | 1.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.12 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|