About 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline
7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline (PubChem CID 134189433) has the molecular formula C18H16BrN
and a molecular weight of 326.24 g/mol. Its IUPAC name is 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline.
Molecular Properties
| Compound Name | 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline |
| PubChem CID | 134189433 |
| Molecular Formula | C18H16BrN |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline |
| SMILES | Cc1cc(C)cc(Cc2cc3ccc(Br)cc3cn2)c1 |
| InChI | InChI=1S/C18H16BrN/c1-12-5-13(2)7-14(6-12)8-18-10-15-3-4-17(19)9-16(15)11-20-18/h3-7,9-11H,8H2,1-2H3 |
| InChIKey | ILISRBMVISMFLU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline?
The IUPAC name of 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline (CID 134189433) is 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline.
What is the SMILES notation for 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline?
The canonical SMILES for 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline is Cc1cc(C)cc(Cc2cc3ccc(Br)cc3cn2)c1.
What is the InChIKey of 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline?
The InChIKey is ILISRBMVISMFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrN/c1-12-5-13(2)7-14(6-12)8-18-10-15-3-4-17(19)9-16(15)11-20-18/h3-7,9-11H,8H2,1-2H3.
What are the key properties of 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline?
7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline has a molecular weight of 326.24 g/mol, XLogP of 5.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-[(3,5-dimethylphenyl)methyl]isoquinoline is sourced from PubChem (CID 134189433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).