C17H34N2O2 — CID 134189516
7,7-dimethyl-1-morpholin-4-yl-2-(propan-2-ylamino)octan-1-one (PubChem CID 134189516) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 7,7-dimethyl-1-morpholin-4-yl-2-(propan-2-ylamino)octan-1-one.
| Compound Name | 7,7-dimethyl-1-morpholin-4-yl-2-(propan-2-ylamino)octan-1-one |
|---|---|
| PubChem CID | 134189516 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 7,7-dimethyl-1-morpholin-4-yl-2-(propan-2-ylamino)octan-1-one |
| SMILES | CC(C)NC(CCCCC(C)(C)C)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H34N2O2/c1-14(2)18-15(8-6-7-9-17(3,4)5)16(20)19-10-12-21-13-11-19/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | UNFYOADZFOEOSL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|