C13H24N2 — CID 134189688
(Z)-3-N,2,2,6,6-pentamethyl-5-N-methylidenehept-4-ene-3,5-diimine (PubChem CID 134189688) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (Z)-3-N,2,2,6,6-pentamethyl-5-N-methylidenehept-4-ene-3,5-diimine.
| Compound Name | (Z)-3-N,2,2,6,6-pentamethyl-5-N-methylidenehept-4-ene-3,5-diimine |
|---|---|
| PubChem CID | 134189688 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (Z)-3-N,2,2,6,6-pentamethyl-5-N-methylidenehept-4-ene-3,5-diimine |
| SMILES | C=N/C(=C\C(=N\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-12(2,3)10(14-7)9-11(15-8)13(4,5)6/h9H,7H2,1-6,8H3/b10-9-,15-11- |
| InChIKey | QEUZCNCIDDZBRE-OUUAWREUSA-N |
| XLogP | 3.73 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|