C23H25Cl4N5P4 — CID 13418976
triphenyl-[(4,4,6,6-tetrachloro-2-piperidin-1-yl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-trien-2-yl)imino]-lambda5-phosphane (PubChem CID 13418976) has the molecular formula C23H25Cl4N5P4 and a molecular weight of 637.20 g/mol. Its IUPAC name is triphenyl-[(4,4,6,6-tetrachloro-2-piperidin-1-yl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-trien-2-yl)imino]-lambda5-phosphane.
| Compound Name | triphenyl-[(4,4,6,6-tetrachloro-2-piperidin-1-yl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-trien-2-yl)imino]-lambda5-phosphane |
|---|---|
| PubChem CID | 13418976 |
| Molecular Formula | C23H25Cl4N5P4 |
| Molecular Weight | 637.20 g/mol |
| Exact Mass | 634.98 |
| IUPAC Name | triphenyl-[(4,4,6,6-tetrachloro-2-piperidin-1-yl-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-trien-2-yl)imino]-lambda5-phosphane |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)(N2CCCCC2)=N1 |
| InChI | InChI=1S/C23H25Cl4N5P4/c24-34(25)29-35(26,27)31-36(30-34,32-19-11-4-12-20-32)28-33(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-3,5-10,13-18H,4,11-12,19-20H2 |
| InChIKey | FKXHSDKORGGDAU-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 52.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.20 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|