C26H25ClN6O3 — CID 134189807
N-[(12E,15S)-18-chloro-5-(methoxymethylamino)-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]-4-cyanobenzamide (PubChem CID 134189807) has the molecular formula C26H25ClN6O3 and a molecular weight of 504.98 g/mol. Its IUPAC name is N-[(12E,15S)-18-chloro-5-(methoxymethylamino)-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]-4-cyanobenzamide.
| Compound Name | N-[(12E,15S)-18-chloro-5-(methoxymethylamino)-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 134189807 |
| Molecular Formula | C26H25ClN6O3 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[(12E,15S)-18-chloro-5-(methoxymethylamino)-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16(19)-hexaen-15-yl]-4-cyanobenzamide |
| SMILES | COCNc1ccc2c(c1)NC(=O)CC/C=C/C[C@H](NC(=O)c1ccc(C#N)cc1)c1nc-2c(Cl)[nH]1 |
| InChI | InChI=1S/C26H25ClN6O3/c1-36-15-29-18-11-12-19-21(13-18)30-22(34)6-4-2-3-5-20(25-32-23(19)24(27)33-25)31-26(35)17-9-7-16(14-28)8-10-17/h2-3,7-13,20,29H,4-6,15H2,1H3,(H,30,34)(H,31,35)(H,32,33)/b3-2+/t20-/m0/s1 |
| InChIKey | OHEIWOLOEZNGPV-NUALSEBGSA-N |
| XLogP | 4.77 |
| TPSA | 131.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|