About 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine
3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine (PubChem CID 134189964) has the molecular formula C15H13N5O
and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine |
| PubChem CID | 134189964 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine |
| SMILES | CCc1noc2cc(Nc3n[nH]c4cccnc34)ccc12 |
| InChI | InChI=1S/C15H13N5O/c1-2-11-10-6-5-9(8-13(10)21-20-11)17-15-14-12(18-19-15)4-3-7-16-14/h3-8H,2H2,1H3,(H2,17,18,19) |
| InChIKey | PPHTWUAKTMFTTE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine?
The IUPAC name of 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine (CID 134189964) is 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine.
What is the SMILES notation for 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine?
The canonical SMILES for 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine is CCc1noc2cc(Nc3n[nH]c4cccnc34)ccc12.
What is the InChIKey of 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine?
The InChIKey is PPHTWUAKTMFTTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O/c1-2-11-10-6-5-9(8-13(10)21-20-11)17-15-14-12(18-19-15)4-3-7-16-14/h3-8H,2H2,1H3,(H2,17,18,19).
What are the key properties of 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine?
3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine has a molecular weight of 279.30 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1,2-benzoxazol-6-amine is sourced from PubChem (CID 134189964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).