About N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine
N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 134189975) has the molecular formula C18H18N4O3
and a molecular weight of 338.37 g/mol. Its IUPAC name is N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 134189975 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | COCCCOc1coc2cc(Nc3n[nH]c4cccnc34)ccc12 |
| InChI | InChI=1S/C18H18N4O3/c1-23-8-3-9-24-16-11-25-15-10-12(5-6-13(15)16)20-18-17-14(21-22-18)4-2-7-19-17/h2,4-7,10-11H,3,8-9H2,1H3,(H2,20,21,22) |
| InChIKey | YPYROJJMLLMOIS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 134189975) is N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine is COCCCOc1coc2cc(Nc3n[nH]c4cccnc34)ccc12.
What is the InChIKey of N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is YPYROJJMLLMOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O3/c1-23-8-3-9-24-16-11-25-15-10-12(5-6-13(15)16)20-18-17-14(21-22-18)4-2-7-19-17/h2,4-7,10-11H,3,8-9H2,1H3,(H2,20,21,22).
What are the key properties of N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 338.37 g/mol, XLogP of 3.86, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-methoxypropoxy)-1-benzofuran-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 134189975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).