C17H16BrNO2 — CID 13419015
1-(3-bromophenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline (PubChem CID 13419015) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 1-(3-bromophenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline.
| Compound Name | 1-(3-bromophenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 13419015 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 1-(3-bromophenyl)-6,7-dimethoxy-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(Br)c1)=NCC2 |
| InChI | InChI=1S/C17H16BrNO2/c1-20-15-9-11-6-7-19-17(14(11)10-16(15)21-2)12-4-3-5-13(18)8-12/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | LLNUCZCKOCDDFS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |