About N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine (PubChem CID 134190197) has the molecular formula C13H7F3N6O
and a molecular weight of 320.23 g/mol. Its IUPAC name is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine.
Molecular Properties
| Compound Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine |
| PubChem CID | 134190197 |
| Molecular Formula | C13H7F3N6O |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine |
| SMILES | FC(F)(F)c1noc2cc(Nc3[nH]nc4nccnc34)ccc12 |
| InChI | InChI=1S/C13H7F3N6O/c14-13(15,16)10-7-2-1-6(5-8(7)23-22-10)19-12-9-11(20-21-12)18-4-3-17-9/h1-5H,(H2,18,19,20,21) |
| InChIKey | SPSQTJMWTGZDTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine?
The IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine (CID 134190197) is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine.
What is the SMILES notation for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine?
The canonical SMILES for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine is FC(F)(F)c1noc2cc(Nc3[nH]nc4nccnc34)ccc12.
What is the InChIKey of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine?
The InChIKey is SPSQTJMWTGZDTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N6O/c14-13(15,16)10-7-2-1-6(5-8(7)23-22-10)19-12-9-11(20-21-12)18-4-3-17-9/h1-5H,(H2,18,19,20,21).
What are the key properties of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine?
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine has a molecular weight of 320.23 g/mol, XLogP of 3.26, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-3-(trifluoromethyl)-1,2-benzoxazol-6-amine is sourced from PubChem (CID 134190197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).