C21H25F3O3 — CID 134190603
3-(4,4-difluorobut-3-enyl)-8-fluoro-7-octoxyisochromen-1-one (PubChem CID 134190603) has the molecular formula C21H25F3O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-(4,4-difluorobut-3-enyl)-8-fluoro-7-octoxyisochromen-1-one.
| Compound Name | 3-(4,4-difluorobut-3-enyl)-8-fluoro-7-octoxyisochromen-1-one |
|---|---|
| PubChem CID | 134190603 |
| Molecular Formula | C21H25F3O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 3-(4,4-difluorobut-3-enyl)-8-fluoro-7-octoxyisochromen-1-one |
| SMILES | CCCCCCCCOc1ccc2cc(CCC=C(F)F)oc(=O)c2c1F |
| InChI | InChI=1S/C21H25F3O3/c1-2-3-4-5-6-7-13-26-17-12-11-15-14-16(9-8-10-18(22)23)27-21(25)19(15)20(17)24/h10-12,14H,2-9,13H2,1H3 |
| InChIKey | GOXKUVBOSCFHJU-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|