C24H25FO3 — CID 134190782
3-[2-(4-but-3-enylphenyl)ethyl]-8-fluoro-7-propoxyisochromen-1-one (PubChem CID 134190782) has the molecular formula C24H25FO3 and a molecular weight of 380.46 g/mol. Its IUPAC name is 3-[2-(4-but-3-enylphenyl)ethyl]-8-fluoro-7-propoxyisochromen-1-one.
| Compound Name | 3-[2-(4-but-3-enylphenyl)ethyl]-8-fluoro-7-propoxyisochromen-1-one |
|---|---|
| PubChem CID | 134190782 |
| Molecular Formula | C24H25FO3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-[2-(4-but-3-enylphenyl)ethyl]-8-fluoro-7-propoxyisochromen-1-one |
| SMILES | C=CCCc1ccc(CCc2cc3ccc(OCCC)c(F)c3c(=O)o2)cc1 |
| InChI | InChI=1S/C24H25FO3/c1-3-5-6-17-7-9-18(10-8-17)11-13-20-16-19-12-14-21(27-15-4-2)23(25)22(19)24(26)28-20/h3,7-10,12,14,16H,1,4-6,11,13,15H2,2H3 |
| InChIKey | NNOAPAXIYJYSPG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|