About 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid
5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 134191464) has the molecular formula C30H19Br2NO2
and a molecular weight of 585.30 g/mol. Its IUPAC name is 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid |
| PubChem CID | 134191464 |
| Molecular Formula | C30H19Br2NO2 |
| Molecular Weight | 585.30 g/mol |
| Exact Mass | 582.98 |
| IUPAC Name | 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2-c2cc(-c3ccccc3Br)cc(-c3ccccc3Br)c2)cn1 |
| InChI | InChI=1S/C30H19Br2NO2/c31-27-11-5-3-9-25(27)21-15-20(16-22(17-21)26-10-4-6-12-28(26)32)24-8-2-1-7-23(24)19-13-14-29(30(34)35)33-18-19/h1-18H,(H,34,35) |
| InChIKey | XOZXRTDOUYRJNZ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 585.30 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid (CID 134191464) is 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid is O=C(O)c1ccc(-c2ccccc2-c2cc(-c3ccccc3Br)cc(-c3ccccc3Br)c2)cn1.
What is the InChIKey of 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid?
The InChIKey is XOZXRTDOUYRJNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H19Br2NO2/c31-27-11-5-3-9-25(27)21-15-20(16-22(17-21)26-10-4-6-12-28(26)32)24-8-2-1-7-23(24)19-13-14-29(30(34)35)33-18-19/h1-18H,(H,34,35).
What are the key properties of 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid?
5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid has a molecular weight of 585.30 g/mol, XLogP of 8.97, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[3,5-bis(2-bromophenyl)phenyl]phenyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 134191464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).