C15H10ClN5 — CID 134191539
1-chloro-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)isoquinolin-6-amine (PubChem CID 134191539) has the molecular formula C15H10ClN5 and a molecular weight of 295.73 g/mol. Its IUPAC name is 1-chloro-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)isoquinolin-6-amine.
| Compound Name | 1-chloro-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)isoquinolin-6-amine |
|---|---|
| PubChem CID | 134191539 |
| Molecular Formula | C15H10ClN5 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 1-chloro-N-(1H-pyrazolo[4,3-b]pyridin-3-yl)isoquinolin-6-amine |
| SMILES | Clc1nccc2cc(Nc3n[nH]c4cccnc34)ccc12 |
| InChI | InChI=1S/C15H10ClN5/c16-14-11-4-3-10(8-9(11)5-7-18-14)19-15-13-12(20-21-15)2-1-6-17-13/h1-8H,(H2,19,20,21) |
| InChIKey | VUGIATVGPBSQNG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|