About 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline
6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline (PubChem CID 134191629) has the molecular formula C10H7BrF3N
and a molecular weight of 278.07 g/mol. Its IUPAC name is 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline |
| PubChem CID | 134191629 |
| Molecular Formula | C10H7BrF3N |
| Molecular Weight | 278.07 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline |
| SMILES | FC(F)(F)C1=NCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H7BrF3N/c11-7-1-2-8-6(5-7)3-4-15-9(8)10(12,13)14/h1-2,5H,3-4H2 |
| InChIKey | UGNZTNHBMRKJPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.07 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline?
The IUPAC name of 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline (CID 134191629) is 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline?
The canonical SMILES for 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline is FC(F)(F)C1=NCCc2cc(Br)ccc21.
What is the InChIKey of 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline?
The InChIKey is UGNZTNHBMRKJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF3N/c11-7-1-2-8-6(5-7)3-4-15-9(8)10(12,13)14/h1-2,5H,3-4H2.
What are the key properties of 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline?
6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline has a molecular weight of 278.07 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-(trifluoromethyl)-3,4-dihydroisoquinoline is sourced from PubChem (CID 134191629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).