About N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine (PubChem CID 134191663) has the molecular formula C15H9F3N6
and a molecular weight of 330.27 g/mol. Its IUPAC name is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine.
Molecular Properties
| Compound Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine |
| PubChem CID | 134191663 |
| Molecular Formula | C15H9F3N6 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine |
| SMILES | FC(F)(F)c1nccc2cc(Nc3[nH]nc4nccnc34)ccc12 |
| InChI | InChI=1S/C15H9F3N6/c16-15(17,18)12-10-2-1-9(7-8(10)3-4-20-12)22-14-11-13(23-24-14)21-6-5-19-11/h1-7H,(H2,21,22,23,24) |
| InChIKey | VJFBADDGNMFOAG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine?
The IUPAC name of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine (CID 134191663) is N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine.
What is the SMILES notation for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine?
The canonical SMILES for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine is FC(F)(F)c1nccc2cc(Nc3[nH]nc4nccnc34)ccc12.
What is the InChIKey of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine?
The InChIKey is VJFBADDGNMFOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N6/c16-15(17,18)12-10-2-1-9(7-8(10)3-4-20-12)22-14-11-13(23-24-14)21-6-5-19-11/h1-7H,(H2,21,22,23,24).
What are the key properties of N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine?
N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine has a molecular weight of 330.27 g/mol, XLogP of 3.66, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2H-pyrazolo[3,4-b]pyrazin-3-yl)-1-(trifluoromethyl)isoquinolin-6-amine is sourced from PubChem (CID 134191663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).