About N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine
N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine (PubChem CID 134191708) has the molecular formula C22H14F3N5O
and a molecular weight of 421.38 g/mol. Its IUPAC name is N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine.
Molecular Properties
| Compound Name | N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine |
| PubChem CID | 134191708 |
| Molecular Formula | C22H14F3N5O |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine |
| SMILES | FC(F)(F)c1ccc(Oc2nccc3cc(Nc4n[nH]c5cccnc45)ccc23)cc1 |
| InChI | InChI=1S/C22H14F3N5O/c23-22(24,25)14-3-6-16(7-4-14)31-21-17-8-5-15(12-13(17)9-11-27-21)28-20-19-18(29-30-20)2-1-10-26-19/h1-12H,(H2,28,29,30) |
| InChIKey | MAHFYZHWUSOHER-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine?
The IUPAC name of N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine (CID 134191708) is N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine.
What is the SMILES notation for N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine?
The canonical SMILES for N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine is FC(F)(F)c1ccc(Oc2nccc3cc(Nc4n[nH]c5cccnc45)ccc23)cc1.
What is the InChIKey of N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine?
The InChIKey is MAHFYZHWUSOHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F3N5O/c23-22(24,25)14-3-6-16(7-4-14)31-21-17-8-5-15(12-13(17)9-11-27-21)28-20-19-18(29-30-20)2-1-10-26-19/h1-12H,(H2,28,29,30).
What are the key properties of N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine?
N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine has a molecular weight of 421.38 g/mol, XLogP of 6.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrazolo[4,3-b]pyridin-3-yl)-1-[4-(trifluoromethyl)phenoxy]isoquinolin-6-amine is sourced from PubChem (CID 134191708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).