About N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine
N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine (PubChem CID 134192167) has the molecular formula C22H19FN6O2
and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| PubChem CID | 134192167 |
| Molecular Formula | C22H19FN6O2 |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine |
| SMILES | Cn1nc(OCCOc2ccccc2F)c2ccc(Nc3n[nH]c4cccnc34)cc21 |
| InChI | InChI=1S/C22H19FN6O2/c1-29-18-13-14(25-21-20-17(26-27-21)6-4-10-24-20)8-9-15(18)22(28-29)31-12-11-30-19-7-3-2-5-16(19)23/h2-10,13H,11-12H2,1H3,(H2,25,26,27) |
| InChIKey | ICEDZXHOLJNAAQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The IUPAC name of N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine (CID 134192167) is N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The canonical SMILES for N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine is Cn1nc(OCCOc2ccccc2F)c2ccc(Nc3n[nH]c4cccnc34)cc21.
What is the InChIKey of N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
The InChIKey is ICEDZXHOLJNAAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN6O2/c1-29-18-13-14(25-21-20-17(26-27-21)6-4-10-24-20)8-9-15(18)22(28-29)31-12-11-30-19-7-3-2-5-16(19)23/h2-10,13H,11-12H2,1H3,(H2,25,26,27).
What are the key properties of N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine?
N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine has a molecular weight of 418.43 g/mol, XLogP of 4.19, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(2-fluorophenoxy)ethoxy]-1-methylindazol-6-yl]-1H-pyrazolo[4,3-b]pyridin-3-amine is sourced from PubChem (CID 134192167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).