About N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine
N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine (PubChem CID 134192218) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine.
Molecular Properties
| Compound Name | N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine |
| PubChem CID | 134192218 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine |
| SMILES | Cc1cn(C)c2ncc(Nc3n[nH]c4ccccc34)cc12 |
| InChI | InChI=1S/C16H15N5/c1-10-9-21(2)16-13(10)7-11(8-17-16)18-15-12-5-3-4-6-14(12)19-20-15/h3-9H,1-2H3,(H2,18,19,20) |
| InChIKey | HNQXRNFQZJNHEN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine?
The IUPAC name of N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine (CID 134192218) is N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine.
What is the SMILES notation for N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine?
The canonical SMILES for N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine is Cc1cn(C)c2ncc(Nc3n[nH]c4ccccc34)cc12.
What is the InChIKey of N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine?
The InChIKey is HNQXRNFQZJNHEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-10-9-21(2)16-13(10)7-11(8-17-16)18-15-12-5-3-4-6-14(12)19-20-15/h3-9H,1-2H3,(H2,18,19,20).
What are the key properties of N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine?
N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine has a molecular weight of 277.33 g/mol, XLogP of 3.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-3-yl)-1,3-dimethylpyrrolo[2,3-b]pyridin-5-amine is sourced from PubChem (CID 134192218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).