C24H21NO3 — CID 134192685
(1R,3S,5S)-1,3,5-triphenyl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one (PubChem CID 134192685) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (1R,3S,5S)-1,3,5-triphenyl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one.
| Compound Name | (1R,3S,5S)-1,3,5-triphenyl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
|---|---|
| PubChem CID | 134192685 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (1R,3S,5S)-1,3,5-triphenyl-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
| SMILES | O=C1OC[C@H](c2ccccc2)N2C1[C@@H](c1ccccc1)O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c26-24-21-22(18-12-6-2-7-13-18)28-23(19-14-8-3-9-15-19)25(21)20(16-27-24)17-10-4-1-5-11-17/h1-15,20-23H,16H2/t20-,21?,22-,23+/m1/s1 |
| InChIKey | GWKMEGVLBXNIFK-GTCWDNOESA-N |
| XLogP | 4.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |