C26H22F3NO3 — CID 134192696
(1R,3S,5S)-3-(4-methylphenyl)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one (PubChem CID 134192696) has the molecular formula C26H22F3NO3 and a molecular weight of 453.46 g/mol. Its IUPAC name is (1R,3S,5S)-3-(4-methylphenyl)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one.
| Compound Name | (1R,3S,5S)-3-(4-methylphenyl)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
|---|---|
| PubChem CID | 134192696 |
| Molecular Formula | C26H22F3NO3 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (1R,3S,5S)-3-(4-methylphenyl)-5-phenyl-1-[4-(trifluoromethyl)phenyl]-3,5,6,8a-tetrahydro-1H-[1,3]oxazolo[4,3-c][1,4]oxazin-8-one |
| SMILES | Cc1ccc([C@@H]2O[C@H](c3ccc(C(F)(F)F)cc3)C3C(=O)OC[C@H](c4ccccc4)N32)cc1 |
| InChI | InChI=1S/C26H22F3NO3/c1-16-7-9-19(10-8-16)24-30-21(17-5-3-2-4-6-17)15-32-25(31)22(30)23(33-24)18-11-13-20(14-12-18)26(27,28)29/h2-14,21-24H,15H2,1H3/t21-,22?,23-,24+/m1/s1 |
| InChIKey | GLRVJQBOVXDLQE-XALAGWIPSA-N |
| XLogP | 5.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |