C19H34O2 — CID 134192881
(1S)-4-tert-butyl-1,2,2,3,5,5,6,6-octamethylcyclohex-3-ene-1-carboxylic acid (PubChem CID 134192881) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (1S)-4-tert-butyl-1,2,2,3,5,5,6,6-octamethylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S)-4-tert-butyl-1,2,2,3,5,5,6,6-octamethylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 134192881 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (1S)-4-tert-butyl-1,2,2,3,5,5,6,6-octamethylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=C(C(C)(C)C)C(C)(C)C(C)(C)[C@@](C)(C(=O)O)C1(C)C |
| InChI | InChI=1S/C19H34O2/c1-12-13(15(2,3)4)17(7,8)18(9,10)19(11,14(20)21)16(12,5)6/h1-11H3,(H,20,21)/t19-/m0/s1 |
| InChIKey | UAEGZWVXGBCBQX-IBGZPJMESA-N |
| XLogP | 5.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|