C54H47N — CID 134194296
N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-N-[4-(2-cyclohexa-2,4-dien-1-ylphenyl)-3-phenylcyclohexa-1,5-dien-1-yl]-3,4-diphenylaniline (PubChem CID 134194296) has the molecular formula C54H47N and a molecular weight of 709.98 g/mol. Its IUPAC name is N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-N-[4-(2-cyclohexa-2,4-dien-1-ylphenyl)-3-phenylcyclohexa-1,5-dien-1-yl]-3,4-diphenylaniline.
| Compound Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-N-[4-(2-cyclohexa-2,4-dien-1-ylphenyl)-3-phenylcyclohexa-1,5-dien-1-yl]-3,4-diphenylaniline |
|---|---|
| PubChem CID | 134194296 |
| Molecular Formula | C54H47N |
| Molecular Weight | 709.98 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | N-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)-N-[4-(2-cyclohexa-2,4-dien-1-ylphenyl)-3-phenylcyclohexa-1,5-dien-1-yl]-3,4-diphenylaniline |
| SMILES | C1=CCCC(C2=CC=C(N(C3=CC(c4ccccc4)C(c4ccccc4C4C=CC=CC4)C=C3)c3ccc(-c4ccccc4)c(-c4ccccc4)c3)CC2)=C1 |
| InChI | InChI=1S/C54H47N/c1-6-18-40(19-7-1)41-30-32-46(33-31-41)55(47-34-36-50(43-22-10-3-11-23-43)53(38-47)44-24-12-4-13-25-44)48-35-37-52(54(39-48)45-26-14-5-15-27-45)51-29-17-16-28-49(51)42-20-8-2-9-21-42/h1-6,8-18,20,22-30,32,34-39,42,52,54H,7,19,21,31,33H2 |
| InChIKey | AZMPFPJASXBWJQ-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.98 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |