C61H49N — CID 134194356
9-cyclohexa-2,4-dien-1-yl-N-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-9-phenyl-N-[3-phenyl-4-(3-phenylphenyl)phenyl]fluoren-2-amine (PubChem CID 134194356) has the molecular formula C61H49N and a molecular weight of 796.07 g/mol. Its IUPAC name is 9-cyclohexa-2,4-dien-1-yl-N-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-9-phenyl-N-[3-phenyl-4-(3-phenylphenyl)phenyl]fluoren-2-amine.
| Compound Name | 9-cyclohexa-2,4-dien-1-yl-N-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-9-phenyl-N-[3-phenyl-4-(3-phenylphenyl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 134194356 |
| Molecular Formula | C61H49N |
| Molecular Weight | 796.07 g/mol |
| Exact Mass | 795.39 |
| IUPAC Name | 9-cyclohexa-2,4-dien-1-yl-N-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-9-phenyl-N-[3-phenyl-4-(3-phenylphenyl)phenyl]fluoren-2-amine |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)N(c1ccc(-c2cccc(-c3ccccc3)c2)c(-c2ccccc2)c1)c1ccc2c(c1)C(c1ccccc1)(C1C=CC=CC1)c1ccccc1-2 |
| InChI | InChI=1S/C61H49N/c1-5-6-22-44(2)45(3)35-36-46(4)62(53-37-39-55(58(42-53)48-25-13-8-14-26-48)50-28-21-27-49(41-50)47-23-11-7-12-24-47)54-38-40-57-56-33-19-20-34-59(56)61(60(57)43-54,51-29-15-9-16-30-51)52-31-17-10-18-32-52/h5-31,33-43,52H,1-4,32H2/b22-6-,36-35- |
| InChIKey | ZXNVJXMYJYUUBB-DBOSSGMOSA-N |
| XLogP | 16.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.07 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|